C14H17N3O — CID 102848202
4-[(4-methyl-3-oxo-1,4-diazepan-1-yl)methyl]benzonitrile (PubChem CID 102848202) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-[(4-methyl-3-oxo-1,4-diazepan-1-yl)methyl]benzonitrile.
| Compound Name | 4-[(4-methyl-3-oxo-1,4-diazepan-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 102848202 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4-[(4-methyl-3-oxo-1,4-diazepan-1-yl)methyl]benzonitrile |
| SMILES | CN1CCCN(Cc2ccc(C#N)cc2)CC1=O |
| InChI | InChI=1S/C14H17N3O/c1-16-7-2-8-17(11-14(16)18)10-13-5-3-12(9-15)4-6-13/h3-6H,2,7-8,10-11H2,1H3 |
| InChIKey | DTQYSTLUUBFWFZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |