C14H17FN2O3 — CID 106699434
2-fluoro-4-[(4-methyl-3-oxo-1,4-diazepan-1-yl)methyl]benzoic acid (PubChem CID 106699434) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is 2-fluoro-4-[(4-methyl-3-oxo-1,4-diazepan-1-yl)methyl]benzoic acid.
| Compound Name | 2-fluoro-4-[(4-methyl-3-oxo-1,4-diazepan-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 106699434 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-fluoro-4-[(4-methyl-3-oxo-1,4-diazepan-1-yl)methyl]benzoic acid |
| SMILES | CN1CCCN(Cc2ccc(C(=O)O)c(F)c2)CC1=O |
| InChI | InChI=1S/C14H17FN2O3/c1-16-5-2-6-17(9-13(16)18)8-10-3-4-11(14(19)20)12(15)7-10/h3-4,7H,2,5-6,8-9H2,1H3,(H,19,20) |
| InChIKey | YFBOIANRNJNZRN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |