C13H15N3O — CID 102846620
4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzonitrile (PubChem CID 102846620) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzonitrile.
| Compound Name | 4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzonitrile |
|---|---|
| PubChem CID | 102846620 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzonitrile |
| SMILES | CN1CCCN(c2ccc(C#N)cc2)CC1=O |
| InChI | InChI=1S/C13H15N3O/c1-15-7-2-8-16(10-13(15)17)12-5-3-11(9-14)4-6-12/h3-6H,2,7-8,10H2,1H3 |
| InChIKey | IHIFBHOFAGTXLC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |