C13H15BrF2N2O — CID 106269267
4-[(3-bromo-2,6-difluorophenyl)methyl]-1-methyl-1,4-diazepan-2-one (PubChem CID 106269267) has the molecular formula C13H15BrF2N2O and a molecular weight of 333.18 g/mol. Its IUPAC name is 4-[(3-bromo-2,6-difluorophenyl)methyl]-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-[(3-bromo-2,6-difluorophenyl)methyl]-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 106269267 |
| Molecular Formula | C13H15BrF2N2O |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 4-[(3-bromo-2,6-difluorophenyl)methyl]-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(Cc2c(F)ccc(Br)c2F)CC1=O |
| InChI | InChI=1S/C13H15BrF2N2O/c1-17-5-2-6-18(8-12(17)19)7-9-11(15)4-3-10(14)13(9)16/h3-4H,2,5-8H2,1H3 |
| InChIKey | JAKRWQGDHJLFFM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|