C16H14BrF2N — CID 106268410
2-[(3-bromo-2,6-difluorophenyl)methyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 106268410) has the molecular formula C16H14BrF2N and a molecular weight of 338.20 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 106268410 |
| Molecular Formula | C16H14BrF2N |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | Fc1ccc(Br)c(F)c1CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H14BrF2N/c17-14-5-6-15(18)13(16(14)19)10-20-8-7-11-3-1-2-4-12(11)9-20/h1-6H,7-10H2 |
| InChIKey | SCFVZZPCBCITAE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|