C16H15Br2NO — CID 107740197
2,6-dibromo-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenol (PubChem CID 107740197) has the molecular formula C16H15Br2NO and a molecular weight of 397.11 g/mol. Its IUPAC name is 2,6-dibromo-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenol.
| Compound Name | 2,6-dibromo-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenol |
|---|---|
| PubChem CID | 107740197 |
| Molecular Formula | C16H15Br2NO |
| Molecular Weight | 397.11 g/mol |
| Exact Mass | 394.95 |
| IUPAC Name | 2,6-dibromo-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenol |
| SMILES | Oc1c(Br)cc(CN2CCc3ccccc3C2)cc1Br |
| InChI | InChI=1S/C16H15Br2NO/c17-14-7-11(8-15(18)16(14)20)9-19-6-5-12-3-1-2-4-13(12)10-19/h1-4,7-8,20H,5-6,9-10H2 |
| InChIKey | DPJNZRTWZOMNAB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.11 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |