About 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol
2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol (PubChem CID 71944660) has the molecular formula C18H21NO
and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol |
| PubChem CID | 71944660 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(CN2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C18H21NO/c1-13-9-14(2)18(20)17(10-13)12-19-8-7-15-5-3-4-6-16(15)11-19/h3-6,9-10,20H,7-8,11-12H2,1-2H3 |
| InChIKey | YJQYGCCKUBWIOH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol?
The IUPAC name of 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol (CID 71944660) is 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol.
What is the SMILES notation for 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol?
The canonical SMILES for 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol is Cc1cc(C)c(O)c(CN2CCc3ccccc3C2)c1.
What is the InChIKey of 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol?
The InChIKey is YJQYGCCKUBWIOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO/c1-13-9-14(2)18(20)17(10-13)12-19-8-7-15-5-3-4-6-16(15)11-19/h3-6,9-10,20H,7-8,11-12H2,1-2H3.
What are the key properties of 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol?
2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol has a molecular weight of 267.37 g/mol, XLogP of 3.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4,6-dimethylphenol is sourced from PubChem (CID 71944660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).