C24H30N2O4 — CID 14960384
1,5-bis[(2-hydroxy-3,5-dimethylphenyl)methyl]-1,5-diazocane-2,6-dione (PubChem CID 14960384) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 1,5-bis[(2-hydroxy-3,5-dimethylphenyl)methyl]-1,5-diazocane-2,6-dione.
| Compound Name | 1,5-bis[(2-hydroxy-3,5-dimethylphenyl)methyl]-1,5-diazocane-2,6-dione |
|---|---|
| PubChem CID | 14960384 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1,5-bis[(2-hydroxy-3,5-dimethylphenyl)methyl]-1,5-diazocane-2,6-dione |
| SMILES | Cc1cc(C)c(O)c(CN2CCC(=O)N(Cc3cc(C)cc(C)c3O)CCC2=O)c1 |
| InChI | InChI=1S/C24H30N2O4/c1-15-9-17(3)23(29)19(11-15)13-25-7-5-22(28)26(8-6-21(25)27)14-20-12-16(2)10-18(4)24(20)30/h9-12,29-30H,5-8,13-14H2,1-4H3 |
| InChIKey | DQGGHVHGYDIAPT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|