C54H66N6O4 — CID 10509811
2,4-dimethyl-6-[[6,14,17-tris[(2-hydroxy-3,5-dimethylphenyl)methyl]-3,6,14,17,23,24-hexazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaen-3-yl]methyl]phenol (PubChem CID 10509811) has the molecular formula C54H66N6O4 and a molecular weight of 863.16 g/mol. Its IUPAC name is 2,4-dimethyl-6-[[6,14,17-tris[(2-hydroxy-3,5-dimethylphenyl)methyl]-3,6,14,17,23,24-hexazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaen-3-yl]methyl]phenol.
| Compound Name | 2,4-dimethyl-6-[[6,14,17-tris[(2-hydroxy-3,5-dimethylphenyl)methyl]-3,6,14,17,23,24-hexazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaen-3-yl]methyl]phenol |
|---|---|
| PubChem CID | 10509811 |
| Molecular Formula | C54H66N6O4 |
| Molecular Weight | 863.16 g/mol |
| Exact Mass | 862.51 |
| IUPAC Name | 2,4-dimethyl-6-[[6,14,17-tris[(2-hydroxy-3,5-dimethylphenyl)methyl]-3,6,14,17,23,24-hexazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaen-3-yl]methyl]phenol |
| SMILES | Cc1cc(C)c(O)c(CN2CCN(Cc3cc(C)cc(C)c3O)Cc3cccc(n3)CN(Cc3cc(C)cc(C)c3O)CCN(Cc3cc(C)cc(C)c3O)Cc3cccc(n3)C2)c1 |
| InChI | InChI=1S/C54H66N6O4/c1-35-19-39(5)51(61)43(23-35)27-57-15-16-58(28-44-24-36(2)20-40(6)52(44)62)32-49-13-10-14-50(56-49)34-60(30-46-26-38(4)22-42(8)54(46)64)18-17-59(33-48-12-9-11-47(31-57)55-48)29-45-25-37(3)21-41(7)53(45)63/h9-14,19-26,61-64H,15-18,27-34H2,1-8H3 |
| InChIKey | MLDUJRXPSDLXDX-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 119.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.16 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|