C15H13BrF2N2 — CID 106264339
1-[(3-bromo-2,6-difluorophenyl)methyl]-2,3-dihydroindol-5-amine (PubChem CID 106264339) has the molecular formula C15H13BrF2N2 and a molecular weight of 339.18 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]-2,3-dihydroindol-5-amine.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-2,3-dihydroindol-5-amine |
|---|---|
| PubChem CID | 106264339 |
| Molecular Formula | C15H13BrF2N2 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-2,3-dihydroindol-5-amine |
| SMILES | Nc1ccc2c(c1)CCN2Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H13BrF2N2/c16-12-2-3-13(17)11(15(12)18)8-20-6-5-9-7-10(19)1-4-14(9)20/h1-4,7H,5-6,8,19H2 |
| InChIKey | ZZKYTKKKQNXQKS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|