C10H12F2N2 — CID 60923081
1-(2,2-difluoroethyl)-2,3-dihydroindol-5-amine (PubChem CID 60923081) has the molecular formula C10H12F2N2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-2,3-dihydroindol-5-amine.
| Compound Name | 1-(2,2-difluoroethyl)-2,3-dihydroindol-5-amine |
|---|---|
| PubChem CID | 60923081 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1-(2,2-difluoroethyl)-2,3-dihydroindol-5-amine |
| SMILES | Nc1ccc2c(c1)CCN2CC(F)F |
| InChI | InChI=1S/C10H12F2N2/c11-10(12)6-14-4-3-7-5-8(13)1-2-9(7)14/h1-2,5,10H,3-4,6,13H2 |
| InChIKey | VKDRJGSILQJQDH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|