C17H18N2 — CID 66417575
1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2,3-dihydroindol-5-amine (PubChem CID 66417575) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2,3-dihydroindol-5-amine.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2,3-dihydroindol-5-amine |
|---|---|
| PubChem CID | 66417575 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2,3-dihydroindol-5-amine |
| SMILES | Nc1ccc2c(c1)CCN2CC1Cc2ccccc21 |
| InChI | InChI=1S/C17H18N2/c18-15-5-6-17-13(10-15)7-8-19(17)11-14-9-12-3-1-2-4-16(12)14/h1-6,10,14H,7-9,11,18H2 |
| InChIKey | MOUXQLPQTXCBGP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|