C14H18N2 — CID 66409968
1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)piperidin-2-imine (PubChem CID 66409968) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)piperidin-2-imine.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)piperidin-2-imine |
|---|---|
| PubChem CID | 66409968 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)piperidin-2-imine |
| SMILES | [H]/N=C1\CCCCN1CC1Cc2ccccc21 |
| InChI | InChI=1S/C14H18N2/c15-14-7-3-4-8-16(14)10-12-9-11-5-1-2-6-13(11)12/h1-2,5-6,12,15H,3-4,7-10H2/b15-14+ |
| InChIKey | RQVKJGNNKGMHQZ-CCEZHUSRSA-N |
| XLogP | 2.79 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|