C13H16N2 — CID 107853052
1-(2,3-dihydro-1H-inden-2-yl)pyrrolidin-2-imine (PubChem CID 107853052) has the molecular formula C13H16N2 and a molecular weight of 200.29 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-2-yl)pyrrolidin-2-imine.
| Compound Name | 1-(2,3-dihydro-1H-inden-2-yl)pyrrolidin-2-imine |
|---|---|
| PubChem CID | 107853052 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-2-yl)pyrrolidin-2-imine |
| SMILES | [H]/N=C1\CCCN1C1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H16N2/c14-13-6-3-7-15(13)12-8-10-4-1-2-5-11(10)9-12/h1-2,4-5,12,14H,3,6-9H2/b14-13+ |
| InChIKey | VXSCQOLGZNQYFY-BUHFOSPRSA-N |
| XLogP | 2.23 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|