C17H16N2O — CID 66394913
(5-amino-2,3-dihydroindol-1-yl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone (PubChem CID 66394913) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is (5-amino-2,3-dihydroindol-1-yl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone.
| Compound Name | (5-amino-2,3-dihydroindol-1-yl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone |
|---|---|
| PubChem CID | 66394913 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (5-amino-2,3-dihydroindol-1-yl)-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)methanone |
| SMILES | Nc1ccc2c(c1)CCN2C(=O)C1Cc2ccccc21 |
| InChI | InChI=1S/C17H16N2O/c18-13-5-6-16-12(9-13)7-8-19(16)17(20)15-10-11-3-1-2-4-14(11)15/h1-6,9,15H,7-8,10,18H2 |
| InChIKey | JOVXARIMOBSPHK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|