C22H19F6NO2 — CID 58857265
7-bicyclo[4.2.0]octa-1,3,5-trienyl-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]methanone (PubChem CID 58857265) has the molecular formula C22H19F6NO2 and a molecular weight of 443.39 g/mol. Its IUPAC name is 7-bicyclo[4.2.0]octa-1,3,5-trienyl-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]methanone.
| Compound Name | 7-bicyclo[4.2.0]octa-1,3,5-trienyl-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]methanone |
|---|---|
| PubChem CID | 58857265 |
| Molecular Formula | C22H19F6NO2 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 7-bicyclo[4.2.0]octa-1,3,5-trienyl-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]methanone |
| SMILES | O=C(C1Cc2ccccc21)N1CCCCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C22H19F6NO2/c23-21(24,25)20(31,22(26,27)28)15-8-9-18-14(11-15)6-3-4-10-29(18)19(30)17-12-13-5-1-2-7-16(13)17/h1-2,5,7-9,11,17,31H,3-4,6,10,12H2 |
| InChIKey | PQGXJDRJUYDAHV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |