C22H19F6NO4 — CID 58857169
2-(1,3-benzodioxol-5-yl)-1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone (PubChem CID 58857169) has the molecular formula C22H19F6NO4 and a molecular weight of 475.39 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone |
|---|---|
| PubChem CID | 58857169 |
| Molecular Formula | C22H19F6NO4 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N1CCCCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C22H19F6NO4/c23-21(24,25)20(31,22(26,27)28)15-5-6-16-14(11-15)3-1-2-8-29(16)19(30)10-13-4-7-17-18(9-13)33-12-32-17/h4-7,9,11,31H,1-3,8,10,12H2 |
| InChIKey | JZWUSODVNYTLBI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |