C20H14ClF8NO2 — CID 16661200
(3-chloro-2,6-difluorophenyl)-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]methanone (PubChem CID 16661200) has the molecular formula C20H14ClF8NO2 and a molecular weight of 487.77 g/mol. Its IUPAC name is (3-chloro-2,6-difluorophenyl)-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]methanone.
| Compound Name | (3-chloro-2,6-difluorophenyl)-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]methanone |
|---|---|
| PubChem CID | 16661200 |
| Molecular Formula | C20H14ClF8NO2 |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | (3-chloro-2,6-difluorophenyl)-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]methanone |
| SMILES | O=C(c1c(F)ccc(Cl)c1F)N1CCCCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H14ClF8NO2/c21-12-5-6-13(22)15(16(12)23)17(31)30-8-2-1-3-10-9-11(4-7-14(10)30)18(32,19(24,25)26)20(27,28)29/h4-7,9,32H,1-3,8H2 |
| InChIKey | KNBMXTLADYAWEK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|