C21H19Cl2F4NO2 — CID 58857211
1-[7-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylethanone (PubChem CID 58857211) has the molecular formula C21H19Cl2F4NO2 and a molecular weight of 464.29 g/mol. Its IUPAC name is 1-[7-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylethanone.
| Compound Name | 1-[7-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 58857211 |
| Molecular Formula | C21H19Cl2F4NO2 |
| Molecular Weight | 464.29 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 1-[7-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CCCCc2cc(C(O)(C(F)(F)Cl)C(F)(F)Cl)ccc21 |
| InChI | InChI=1S/C21H19Cl2F4NO2/c22-20(24,25)19(30,21(23,26)27)16-9-10-17-15(13-16)8-4-5-11-28(17)18(29)12-14-6-2-1-3-7-14/h1-3,6-7,9-10,13,30H,4-5,8,11-12H2 |
| InChIKey | MGJZEDJDCGXYHK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.29 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|