C22H21F6NO2 — CID 16659899
(2S)-1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one (PubChem CID 16659899) has the molecular formula C22H21F6NO2 and a molecular weight of 445.40 g/mol. Its IUPAC name is (2S)-1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one.
| Compound Name | (2S)-1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 16659899 |
| Molecular Formula | C22H21F6NO2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (2S)-1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one |
| SMILES | C[C@H](C(=O)N1CCCCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21)c1ccccc1 |
| InChI | InChI=1S/C22H21F6NO2/c1-14(15-7-3-2-4-8-15)19(30)29-12-6-5-9-16-13-17(10-11-18(16)29)20(31,21(23,24)25)22(26,27)28/h2-4,7-8,10-11,13-14,31H,5-6,9,12H2,1H3/t14-/m0/s1 |
| InChIKey | VMYFWHNWAARSIT-AWEZNQCLSA-N |
| XLogP | 5.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |