C28H24ClF6NO3 — CID 73301139
1-[3-(2-chlorophenoxy)-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one (PubChem CID 73301139) has the molecular formula C28H24ClF6NO3 and a molecular weight of 571.95 g/mol. Its IUPAC name is 1-[3-(2-chlorophenoxy)-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one.
| Compound Name | 1-[3-(2-chlorophenoxy)-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 73301139 |
| Molecular Formula | C28H24ClF6NO3 |
| Molecular Weight | 571.95 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | 1-[3-(2-chlorophenoxy)-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one |
| SMILES | CC(C(=O)N1CC(Oc2ccccc2Cl)CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21)c1ccccc1 |
| InChI | InChI=1S/C28H24ClF6NO3/c1-17(18-7-3-2-4-8-18)25(37)36-16-21(39-24-10-6-5-9-22(24)29)13-11-19-15-20(12-14-23(19)36)26(38,27(30,31)32)28(33,34)35/h2-10,12,14-15,17,21,38H,11,13,16H2,1H3 |
| InChIKey | WQUSRQJDHJUJJA-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.95 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |