C37H32ClF6NO4 — CID 87546322
[2-[3-(3-chlorophenoxy)-1-(2-phenylpropanoyl)-2,3,4,5-tetrahydro-1-benzazepin-7-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-phenylpropanoate (PubChem CID 87546322) has the molecular formula C37H32ClF6NO4 and a molecular weight of 704.11 g/mol. Its IUPAC name is [2-[3-(3-chlorophenoxy)-1-(2-phenylpropanoyl)-2,3,4,5-tetrahydro-1-benzazepin-7-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-phenylpropanoate.
| Compound Name | [2-[3-(3-chlorophenoxy)-1-(2-phenylpropanoyl)-2,3,4,5-tetrahydro-1-benzazepin-7-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-phenylpropanoate |
|---|---|
| PubChem CID | 87546322 |
| Molecular Formula | C37H32ClF6NO4 |
| Molecular Weight | 704.11 g/mol |
| Exact Mass | 703.19 |
| IUPAC Name | [2-[3-(3-chlorophenoxy)-1-(2-phenylpropanoyl)-2,3,4,5-tetrahydro-1-benzazepin-7-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-phenylpropanoate |
| SMILES | CC(C(=O)OC(c1ccc2c(c1)CCC(Oc1cccc(Cl)c1)CN2C(=O)C(C)c1ccccc1)(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C37H32ClF6NO4/c1-23(25-10-5-3-6-11-25)33(46)45-22-31(48-30-15-9-14-29(38)21-30)18-16-27-20-28(17-19-32(27)45)35(36(39,40)41,37(42,43)44)49-34(47)24(2)26-12-7-4-8-13-26/h3-15,17,19-21,23-24,31H,16,18,22H2,1-2H3 |
| InChIKey | APFIIPCCOIXDGH-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.11 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |