C27H22F9N3O3 — CID 73301141
1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-[6-(trifluoromethyl)pyrimidin-4-yl]oxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one (PubChem CID 73301141) has the molecular formula C27H22F9N3O3 and a molecular weight of 607.47 g/mol. Its IUPAC name is 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-[6-(trifluoromethyl)pyrimidin-4-yl]oxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one.
| Compound Name | 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-[6-(trifluoromethyl)pyrimidin-4-yl]oxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 73301141 |
| Molecular Formula | C27H22F9N3O3 |
| Molecular Weight | 607.47 g/mol |
| Exact Mass | 607.15 |
| IUPAC Name | 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-[6-(trifluoromethyl)pyrimidin-4-yl]oxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one |
| SMILES | CC(C(=O)N1CC(Oc2cc(C(F)(F)F)ncn2)CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21)c1ccccc1 |
| InChI | InChI=1S/C27H22F9N3O3/c1-15(16-5-3-2-4-6-16)23(40)39-13-19(42-22-12-21(25(28,29)30)37-14-38-22)9-7-17-11-18(8-10-20(17)39)24(41,26(31,32)33)27(34,35)36/h2-6,8,10-12,14-15,19,41H,7,9,13H2,1H3 |
| InChIKey | VWOQBMZROPCDTF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.47 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |