C22H21F6NO3 — CID 73301173
1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-hydroxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one (PubChem CID 73301173) has the molecular formula C22H21F6NO3 and a molecular weight of 461.40 g/mol. Its IUPAC name is 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-hydroxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one.
| Compound Name | 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-hydroxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 73301173 |
| Molecular Formula | C22H21F6NO3 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-hydroxy-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one |
| SMILES | CC(C(=O)N1CC(O)CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21)c1ccccc1 |
| InChI | InChI=1S/C22H21F6NO3/c1-13(14-5-3-2-4-6-14)19(31)29-12-17(30)9-7-15-11-16(8-10-18(15)29)20(32,21(23,24)25)22(26,27)28/h2-6,8,10-11,13,17,30,32H,7,9,12H2,1H3 |
| InChIKey | QOFHLVSJPAXODW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |