C18H15F6NO2 — CID 91019979
[2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-phenylpropanoate (PubChem CID 91019979) has the molecular formula C18H15F6NO2 and a molecular weight of 391.31 g/mol. Its IUPAC name is [2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-phenylpropanoate.
| Compound Name | [2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-phenylpropanoate |
|---|---|
| PubChem CID | 91019979 |
| Molecular Formula | C18H15F6NO2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-phenylpropanoate |
| SMILES | CC(C(=O)OC(c1ccc(N)cc1)(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H15F6NO2/c1-11(12-5-3-2-4-6-12)15(26)27-16(17(19,20)21,18(22,23)24)13-7-9-14(25)10-8-13/h2-11H,25H2,1H3 |
| InChIKey | TXUXOYHAXZUZFP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|