C30H21F6NO3 — CID 2314893
[2-[4-[(2,2-diphenylacetyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] benzoate (PubChem CID 2314893) has the molecular formula C30H21F6NO3 and a molecular weight of 557.49 g/mol. Its IUPAC name is [2-[4-[(2,2-diphenylacetyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] benzoate.
| Compound Name | [2-[4-[(2,2-diphenylacetyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] benzoate |
|---|---|
| PubChem CID | 2314893 |
| Molecular Formula | C30H21F6NO3 |
| Molecular Weight | 557.49 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | [2-[4-[(2,2-diphenylacetyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] benzoate |
| SMILES | O=C(OC(c1ccc(NC(=O)C(c2ccccc2)c2ccccc2)cc1)(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C30H21F6NO3/c31-29(32,33)28(30(34,35)36,40-27(39)22-14-8-3-9-15-22)23-16-18-24(19-17-23)37-26(38)25(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-19,25H,(H,37,38) |
| InChIKey | RDNAQXZGYRYQIG-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.49 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |