About 2-phenylpropan-2-yl 4-benzamidobenzoate
2-phenylpropan-2-yl 4-benzamidobenzoate (PubChem CID 58709253) has the molecular formula C23H21NO3
and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-phenylpropan-2-yl 4-benzamidobenzoate.
Molecular Properties
| Compound Name | 2-phenylpropan-2-yl 4-benzamidobenzoate |
| PubChem CID | 58709253 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-phenylpropan-2-yl 4-benzamidobenzoate |
| SMILES | CC(C)(OC(=O)c1ccc(NC(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H21NO3/c1-23(2,19-11-7-4-8-12-19)27-22(26)18-13-15-20(16-14-18)24-21(25)17-9-5-3-6-10-17/h3-16H,1-2H3,(H,24,25) |
| InChIKey | NRTYUUKRRBEPRG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylpropan-2-yl 4-benzamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpropan-2-yl 4-benzamidobenzoate?
The IUPAC name of 2-phenylpropan-2-yl 4-benzamidobenzoate (CID 58709253) is 2-phenylpropan-2-yl 4-benzamidobenzoate.
What is the SMILES notation for 2-phenylpropan-2-yl 4-benzamidobenzoate?
The canonical SMILES for 2-phenylpropan-2-yl 4-benzamidobenzoate is CC(C)(OC(=O)c1ccc(NC(=O)c2ccccc2)cc1)c1ccccc1.
What is the InChIKey of 2-phenylpropan-2-yl 4-benzamidobenzoate?
The InChIKey is NRTYUUKRRBEPRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO3/c1-23(2,19-11-7-4-8-12-19)27-22(26)18-13-15-20(16-14-18)24-21(25)17-9-5-3-6-10-17/h3-16H,1-2H3,(H,24,25).
What are the key properties of 2-phenylpropan-2-yl 4-benzamidobenzoate?
2-phenylpropan-2-yl 4-benzamidobenzoate has a molecular weight of 359.43 g/mol, XLogP of 5.03, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpropan-2-yl 4-benzamidobenzoate is sourced from PubChem (CID 58709253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).