C22H17F3N2O4 — CID 87444403
N-[4-[2-(hydroxyamino)-2-oxo-1-phenylethyl]phenyl]-4-(trifluoromethoxy)benzamide (PubChem CID 87444403) has the molecular formula C22H17F3N2O4 and a molecular weight of 430.38 g/mol. Its IUPAC name is N-[4-[2-(hydroxyamino)-2-oxo-1-phenylethyl]phenyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[4-[2-(hydroxyamino)-2-oxo-1-phenylethyl]phenyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 87444403 |
| Molecular Formula | C22H17F3N2O4 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N-[4-[2-(hydroxyamino)-2-oxo-1-phenylethyl]phenyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(Nc1ccc(C(C(=O)NO)c2ccccc2)cc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H17F3N2O4/c23-22(24,25)31-18-12-8-16(9-13-18)20(28)26-17-10-6-15(7-11-17)19(21(29)27-30)14-4-2-1-3-5-14/h1-13,19,30H,(H,26,28)(H,27,29) |
| InChIKey | WJIZETIGCDBRRO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|