C28H24ClF6NO4 — CID 16661343
2-(3-chlorophenyl)-1-[(3S)-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-(3-methoxyphenoxy)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone (PubChem CID 16661343) has the molecular formula C28H24ClF6NO4 and a molecular weight of 587.94 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[(3S)-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-(3-methoxyphenoxy)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone.
| Compound Name | 2-(3-chlorophenyl)-1-[(3S)-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-(3-methoxyphenoxy)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone |
|---|---|
| PubChem CID | 16661343 |
| Molecular Formula | C28H24ClF6NO4 |
| Molecular Weight | 587.94 g/mol |
| Exact Mass | 587.13 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[(3S)-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-(3-methoxyphenoxy)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone |
| SMILES | COc1cccc(O[C@H]2CCc3cc(C(O)(C(F)(F)F)C(F)(F)F)ccc3N(C(=O)Cc3cccc(Cl)c3)C2)c1 |
| InChI | InChI=1S/C28H24ClF6NO4/c1-39-21-6-3-7-22(15-21)40-23-10-8-18-14-19(26(38,27(30,31)32)28(33,34)35)9-11-24(18)36(16-23)25(37)13-17-4-2-5-20(29)12-17/h2-7,9,11-12,14-15,23,38H,8,10,13,16H2,1H3/t23-/m0/s1 |
| InChIKey | WRVFUOBLQJHFBG-QHCPKHFHSA-N |
| XLogP | 6.63 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.94 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |