C22H20ClF4NO2 — CID 89362328
2-(3-chlorophenyl)-1-[7-(1,1,1,3-tetrafluoro-2-hydroxybut-3-en-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone (PubChem CID 89362328) has the molecular formula C22H20ClF4NO2 and a molecular weight of 441.85 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[7-(1,1,1,3-tetrafluoro-2-hydroxybut-3-en-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone.
| Compound Name | 2-(3-chlorophenyl)-1-[7-(1,1,1,3-tetrafluoro-2-hydroxybut-3-en-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone |
|---|---|
| PubChem CID | 89362328 |
| Molecular Formula | C22H20ClF4NO2 |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[7-(1,1,1,3-tetrafluoro-2-hydroxybut-3-en-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone |
| SMILES | C=C(F)C(O)(c1ccc2c(c1)CCCCN2C(=O)Cc1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C22H20ClF4NO2/c1-14(24)21(30,22(25,26)27)17-8-9-19-16(13-17)6-2-3-10-28(19)20(29)12-15-5-4-7-18(23)11-15/h4-5,7-9,11,13,30H,1-3,6,10,12H2 |
| InChIKey | AOUWSADMODDRDQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |