C21H25F4NO2 — CID 59344804
2-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[7-(1,2,2,2-tetrafluoro-1-hydroxyethyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone (PubChem CID 59344804) has the molecular formula C21H25F4NO2 and a molecular weight of 399.43 g/mol. Its IUPAC name is 2-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[7-(1,2,2,2-tetrafluoro-1-hydroxyethyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone.
| Compound Name | 2-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[7-(1,2,2,2-tetrafluoro-1-hydroxyethyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone |
|---|---|
| PubChem CID | 59344804 |
| Molecular Formula | C21H25F4NO2 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[7-(1,2,2,2-tetrafluoro-1-hydroxyethyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone |
| SMILES | O=C(CC1C[C@H]2CC[C@@H]1C2)N1CCCCc2cc(C(O)(F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C21H25F4NO2/c22-20(28,21(23,24)25)17-6-7-18-15(11-17)3-1-2-8-26(18)19(27)12-16-10-13-4-5-14(16)9-13/h6-7,11,13-14,16,28H,1-5,8-10,12H2/t13-,14+,16?,20?/m0/s1 |
| InChIKey | LUGVZVORSPUYAU-VNCCEEBVSA-N |
| XLogP | 4.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |