C20H19F4NO2 — CID 59344774
2-phenyl-1-[7-(1,2,2,2-tetrafluoro-1-hydroxyethyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone (PubChem CID 59344774) has the molecular formula C20H19F4NO2 and a molecular weight of 381.37 g/mol. Its IUPAC name is 2-phenyl-1-[7-(1,2,2,2-tetrafluoro-1-hydroxyethyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone.
| Compound Name | 2-phenyl-1-[7-(1,2,2,2-tetrafluoro-1-hydroxyethyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone |
|---|---|
| PubChem CID | 59344774 |
| Molecular Formula | C20H19F4NO2 |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-phenyl-1-[7-(1,2,2,2-tetrafluoro-1-hydroxyethyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone |
| SMILES | O=C(Cc1ccccc1)N1CCCCc2cc(C(O)(F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H19F4NO2/c21-19(27,20(22,23)24)16-9-10-17-15(13-16)8-4-5-11-25(17)18(26)12-14-6-2-1-3-7-14/h1-3,6-7,9-10,13,27H,4-5,8,11-12H2 |
| InChIKey | ZDNFPHPTGFBSJC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |