C21H21F4NO3 — CID 59344805
2-(2-methoxyphenyl)-1-[7-(1,2,2,2-tetrafluoro-1-hydroxyethyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone (PubChem CID 59344805) has the molecular formula C21H21F4NO3 and a molecular weight of 411.40 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1-[7-(1,2,2,2-tetrafluoro-1-hydroxyethyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone.
| Compound Name | 2-(2-methoxyphenyl)-1-[7-(1,2,2,2-tetrafluoro-1-hydroxyethyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone |
|---|---|
| PubChem CID | 59344805 |
| Molecular Formula | C21H21F4NO3 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-(2-methoxyphenyl)-1-[7-(1,2,2,2-tetrafluoro-1-hydroxyethyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanone |
| SMILES | COc1ccccc1CC(=O)N1CCCCc2cc(C(O)(F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C21H21F4NO3/c1-29-18-8-3-2-7-15(18)13-19(27)26-11-5-4-6-14-12-16(9-10-17(14)26)20(22,28)21(23,24)25/h2-3,7-10,12,28H,4-6,11,13H2,1H3 |
| InChIKey | DFISVKHFWJEIAB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |