C18H15F6NO2S — CID 58857201
[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-thiophen-2-ylmethanone (PubChem CID 58857201) has the molecular formula C18H15F6NO2S and a molecular weight of 423.38 g/mol. Its IUPAC name is [7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 58857201 |
| Molecular Formula | C18H15F6NO2S |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | [7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCCCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H15F6NO2S/c19-17(20,21)16(27,18(22,23)24)12-6-7-13-11(10-12)4-1-2-8-25(13)15(26)14-5-3-9-28-14/h3,5-7,9-10,27H,1-2,4,8H2 |
| InChIKey | AGNDMGQAJFGOFA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |