About (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone
(6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone (PubChem CID 114558361) has the molecular formula C16H14BrFN2O
and a molecular weight of 349.20 g/mol. Its IUPAC name is (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone.
Molecular Properties
| Compound Name | (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone |
| PubChem CID | 114558361 |
| Molecular Formula | C16H14BrFN2O |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone |
| SMILES | Nc1ccc2c(c1)CCCN2C(=O)c1c(F)cccc1Br |
| InChI | InChI=1S/C16H14BrFN2O/c17-12-4-1-5-13(18)15(12)16(21)20-8-2-3-10-9-11(19)6-7-14(10)20/h1,4-7,9H,2-3,8,19H2 |
| InChIKey | SFUYZQNIJHDGPA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone?
The IUPAC name of (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone (CID 114558361) is (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone.
What is the SMILES notation for (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone?
The canonical SMILES for (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone is Nc1ccc2c(c1)CCCN2C(=O)c1c(F)cccc1Br.
What is the InChIKey of (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone?
The InChIKey is SFUYZQNIJHDGPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrFN2O/c17-12-4-1-5-13(18)15(12)16(21)20-8-2-3-10-9-11(19)6-7-14(10)20/h1,4-7,9H,2-3,8,19H2.
What are the key properties of (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone?
(6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone has a molecular weight of 349.20 g/mol, XLogP of 3.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-6-fluorophenyl)methanone is sourced from PubChem (CID 114558361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).