C16H14BrClN2O — CID 107986323
(7-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-4-chlorophenyl)methanone (PubChem CID 107986323) has the molecular formula C16H14BrClN2O and a molecular weight of 365.66 g/mol. Its IUPAC name is (7-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-4-chlorophenyl)methanone.
| Compound Name | (7-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 107986323 |
| Molecular Formula | C16H14BrClN2O |
| Molecular Weight | 365.66 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | (7-amino-3,4-dihydro-2H-quinolin-1-yl)-(2-bromo-4-chlorophenyl)methanone |
| SMILES | Nc1ccc2c(c1)N(C(=O)c1ccc(Cl)cc1Br)CCC2 |
| InChI | InChI=1S/C16H14BrClN2O/c17-14-8-11(18)4-6-13(14)16(21)20-7-1-2-10-3-5-12(19)9-15(10)20/h3-6,8-9H,1-2,7,19H2 |
| InChIKey | VZELQOOIAJMTAZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|