C18H20N2O — CID 62266897
(7-amino-3,4-dihydro-2H-quinolin-1-yl)-(2,4-dimethylphenyl)methanone (PubChem CID 62266897) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is (7-amino-3,4-dihydro-2H-quinolin-1-yl)-(2,4-dimethylphenyl)methanone.
| Compound Name | (7-amino-3,4-dihydro-2H-quinolin-1-yl)-(2,4-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 62266897 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (7-amino-3,4-dihydro-2H-quinolin-1-yl)-(2,4-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCCc3ccc(N)cc32)c(C)c1 |
| InChI | InChI=1S/C18H20N2O/c1-12-5-8-16(13(2)10-12)18(21)20-9-3-4-14-6-7-15(19)11-17(14)20/h5-8,10-11H,3-4,9,19H2,1-2H3 |
| InChIKey | SKRGPGPPNBNESK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|