C16H15BrN2O — CID 65306128
(6-amino-2,3-dihydroindol-1-yl)-(5-bromo-2-methylphenyl)methanone (PubChem CID 65306128) has the molecular formula C16H15BrN2O and a molecular weight of 331.21 g/mol. Its IUPAC name is (6-amino-2,3-dihydroindol-1-yl)-(5-bromo-2-methylphenyl)methanone.
| Compound Name | (6-amino-2,3-dihydroindol-1-yl)-(5-bromo-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 65306128 |
| Molecular Formula | C16H15BrN2O |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (6-amino-2,3-dihydroindol-1-yl)-(5-bromo-2-methylphenyl)methanone |
| SMILES | Cc1ccc(Br)cc1C(=O)N1CCc2ccc(N)cc21 |
| InChI | InChI=1S/C16H15BrN2O/c1-10-2-4-12(17)8-14(10)16(20)19-7-6-11-3-5-13(18)9-15(11)19/h2-5,8-9H,6-7,18H2,1H3 |
| InChIKey | VDLCBHWPFYZICW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|