C15H13IN2O — CID 28978839
(6-amino-2,3-dihydroindol-1-yl)-(3-iodophenyl)methanone (PubChem CID 28978839) has the molecular formula C15H13IN2O and a molecular weight of 364.19 g/mol. Its IUPAC name is (6-amino-2,3-dihydroindol-1-yl)-(3-iodophenyl)methanone.
| Compound Name | (6-amino-2,3-dihydroindol-1-yl)-(3-iodophenyl)methanone |
|---|---|
| PubChem CID | 28978839 |
| Molecular Formula | C15H13IN2O |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | (6-amino-2,3-dihydroindol-1-yl)-(3-iodophenyl)methanone |
| SMILES | Nc1ccc2c(c1)N(C(=O)c1cccc(I)c1)CC2 |
| InChI | InChI=1S/C15H13IN2O/c16-12-3-1-2-11(8-12)15(19)18-7-6-10-4-5-13(17)9-14(10)18/h1-5,8-9H,6-7,17H2 |
| InChIKey | FSXZKFIQMRRBKN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|