C11H15N3O — CID 43164814
6-amino-N-ethyl-2,3-dihydroindole-1-carboxamide (PubChem CID 43164814) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 6-amino-N-ethyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | 6-amino-N-ethyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 43164814 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 6-amino-N-ethyl-2,3-dihydroindole-1-carboxamide |
| SMILES | CCNC(=O)N1CCc2ccc(N)cc21 |
| InChI | InChI=1S/C11H15N3O/c1-2-13-11(15)14-6-5-8-3-4-9(12)7-10(8)14/h3-4,7H,2,5-6,12H2,1H3,(H,13,15) |
| InChIKey | KGTBVPUDYLTAHD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|