C13H17N3O3 — CID 113382414
1-(3-aminopropylcarbamoyl)-2,3-dihydroindole-6-carboxylic acid (PubChem CID 113382414) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-(3-aminopropylcarbamoyl)-2,3-dihydroindole-6-carboxylic acid.
| Compound Name | 1-(3-aminopropylcarbamoyl)-2,3-dihydroindole-6-carboxylic acid |
|---|---|
| PubChem CID | 113382414 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-(3-aminopropylcarbamoyl)-2,3-dihydroindole-6-carboxylic acid |
| SMILES | NCCCNC(=O)N1CCc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C13H17N3O3/c14-5-1-6-15-13(19)16-7-4-9-2-3-10(12(17)18)8-11(9)16/h2-3,8H,1,4-7,14H2,(H,15,19)(H,17,18) |
| InChIKey | YWDHPTPPIHUSIL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|