C12H13ClN2O3 — CID 122018695
3-[(6-chloro-2,3-dihydroindole-1-carbonyl)amino]propanoic acid (PubChem CID 122018695) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 3-[(6-chloro-2,3-dihydroindole-1-carbonyl)amino]propanoic acid.
| Compound Name | 3-[(6-chloro-2,3-dihydroindole-1-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 122018695 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 3-[(6-chloro-2,3-dihydroindole-1-carbonyl)amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)N1CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H13ClN2O3/c13-9-2-1-8-4-6-15(10(8)7-9)12(18)14-5-3-11(16)17/h1-2,7H,3-6H2,(H,14,18)(H,16,17) |
| InChIKey | QELGXMFJOMXQKO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |