C9H7Cl2NO — CID 139548954
6-chloro-2,3-dihydroindole-1-carbonyl chloride (PubChem CID 139548954) has the molecular formula C9H7Cl2NO and a molecular weight of 216.07 g/mol. Its IUPAC name is 6-chloro-2,3-dihydroindole-1-carbonyl chloride.
| Compound Name | 6-chloro-2,3-dihydroindole-1-carbonyl chloride |
|---|---|
| PubChem CID | 139548954 |
| Molecular Formula | C9H7Cl2NO |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 6-chloro-2,3-dihydroindole-1-carbonyl chloride |
| SMILES | O=C(Cl)N1CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H7Cl2NO/c10-7-2-1-6-3-4-12(9(11)13)8(6)5-7/h1-2,5H,3-4H2 |
| InChIKey | IDPYZZIXIBTNCV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|