C14H9Cl2NO2S — CID 15341021
3-chloro-11-oxo-6H-benzo[b][1,4]benzothiazepine-5-carbonyl chloride (PubChem CID 15341021) has the molecular formula C14H9Cl2NO2S and a molecular weight of 326.20 g/mol. Its IUPAC name is 3-chloro-11-oxo-6H-benzo[b][1,4]benzothiazepine-5-carbonyl chloride.
| Compound Name | 3-chloro-11-oxo-6H-benzo[b][1,4]benzothiazepine-5-carbonyl chloride |
|---|---|
| PubChem CID | 15341021 |
| Molecular Formula | C14H9Cl2NO2S |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | 3-chloro-11-oxo-6H-benzo[b][1,4]benzothiazepine-5-carbonyl chloride |
| SMILES | O=C(Cl)N1Cc2ccccc2S(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H9Cl2NO2S/c15-10-5-6-13-11(7-10)17(14(16)18)8-9-3-1-2-4-12(9)20(13)19/h1-7H,8H2 |
| InChIKey | WYPOYBWHYVFKPK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|