2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate

C11H8Cl5NO3 — CID 159058677

IUPAC2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate
SMILESO=C(Cl)N1CCc2ccccc21.O=C(Cl)OC(Cl)(Cl)Cl
InChIInChI=1S/C9H8ClNO.C2Cl4O2/c10-9(12)11-6-5-7-3-1-2-4-8(7)11;3-1(7)8-2(4,5)6/h1-4H,5-6H2;
InChIKeyJYEKUQHJRKGKCF-UHFFFAOYSA-N
MW379.45 g/mol
LogP5.10
Rot. Bonds

About 2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate

2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate (PubChem CID 159058677) has the molecular formula C11H8Cl5NO3 and a molecular weight of 379.45 g/mol. Its IUPAC name is 2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate.

Molecular Properties

Compound Name2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate
PubChem CID159058677
Molecular FormulaC11H8Cl5NO3
Molecular Weight379.45 g/mol
Exact Mass376.89
IUPAC Name2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate
SMILESO=C(Cl)N1CCc2ccccc21.O=C(Cl)OC(Cl)(Cl)Cl
InChIInChI=1S/C9H8ClNO.C2Cl4O2/c10-9(12)11-6-5-7-3-1-2-4-8(7)11;3-1(7)8-2(4,5)6/h1-4H,5-6H2;
InChIKeyJYEKUQHJRKGKCF-UHFFFAOYSA-N
XLogP5.10
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms20
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500379.45
LogP ≤ 55.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze 2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate?
The IUPAC name of 2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate (CID 159058677) is 2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate.
What is the SMILES notation for 2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate?
The canonical SMILES for 2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate is O=C(Cl)N1CCc2ccccc21.O=C(Cl)OC(Cl)(Cl)Cl.
What is the InChIKey of 2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate?
The InChIKey is JYEKUQHJRKGKCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO.C2Cl4O2/c10-9(12)11-6-5-7-3-1-2-4-8(7)11;3-1(7)8-2(4,5)6/h1-4H,5-6H2;.
What are the key properties of 2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate?
2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate has a molecular weight of 379.45 g/mol, XLogP of 5.10, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate is sourced from PubChem (CID 159058677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).