C11H8Cl5NO3 — CID 159058677
2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate (PubChem CID 159058677) has the molecular formula C11H8Cl5NO3 and a molecular weight of 379.45 g/mol. Its IUPAC name is 2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate.
| Compound Name | 2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate |
|---|---|
| PubChem CID | 159058677 |
| Molecular Formula | C11H8Cl5NO3 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 376.89 |
| IUPAC Name | 2,3-dihydroindole-1-carbonyl chloride;trichloromethyl carbonochloridate |
| SMILES | O=C(Cl)N1CCc2ccccc21.O=C(Cl)OC(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H8ClNO.C2Cl4O2/c10-9(12)11-6-5-7-3-1-2-4-8(7)11;3-1(7)8-2(4,5)6/h1-4H,5-6H2; |
| InChIKey | JYEKUQHJRKGKCF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|