C17H12ClN3O2 — CID 167785269
4-(6-chloro-2,3-dihydroindole-1-carbonyl)-2H-phthalazin-1-one (PubChem CID 167785269) has the molecular formula C17H12ClN3O2 and a molecular weight of 325.76 g/mol. Its IUPAC name is 4-(6-chloro-2,3-dihydroindole-1-carbonyl)-2H-phthalazin-1-one.
| Compound Name | 4-(6-chloro-2,3-dihydroindole-1-carbonyl)-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 167785269 |
| Molecular Formula | C17H12ClN3O2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 4-(6-chloro-2,3-dihydroindole-1-carbonyl)-2H-phthalazin-1-one |
| SMILES | O=C(c1n[nH]c(=O)c2ccccc12)N1CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H12ClN3O2/c18-11-6-5-10-7-8-21(14(10)9-11)17(23)15-12-3-1-2-4-13(12)16(22)20-19-15/h1-6,9H,7-8H2,(H,20,22) |
| InChIKey | SYTXYCFKSMEENO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |