C20H18ClFN4O2 — CID 46684946
4-[4-[(2-chloro-6-fluorophenyl)methyl]piperazine-1-carbonyl]-2H-phthalazin-1-one (PubChem CID 46684946) has the molecular formula C20H18ClFN4O2 and a molecular weight of 400.84 g/mol. Its IUPAC name is 4-[4-[(2-chloro-6-fluorophenyl)methyl]piperazine-1-carbonyl]-2H-phthalazin-1-one.
| Compound Name | 4-[4-[(2-chloro-6-fluorophenyl)methyl]piperazine-1-carbonyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 46684946 |
| Molecular Formula | C20H18ClFN4O2 |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 4-[4-[(2-chloro-6-fluorophenyl)methyl]piperazine-1-carbonyl]-2H-phthalazin-1-one |
| SMILES | O=C(c1n[nH]c(=O)c2ccccc12)N1CCN(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C20H18ClFN4O2/c21-16-6-3-7-17(22)15(16)12-25-8-10-26(11-9-25)20(28)18-13-4-1-2-5-14(13)19(27)24-23-18/h1-7H,8-12H2,(H,24,27) |
| InChIKey | BBLBFUXVSFKDKE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |