C22H20N4O2S — CID 39979475
4-[4-(1-benzothiophen-3-ylmethyl)piperazine-1-carbonyl]-2H-phthalazin-1-one (PubChem CID 39979475) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is 4-[4-(1-benzothiophen-3-ylmethyl)piperazine-1-carbonyl]-2H-phthalazin-1-one.
| Compound Name | 4-[4-(1-benzothiophen-3-ylmethyl)piperazine-1-carbonyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 39979475 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 4-[4-(1-benzothiophen-3-ylmethyl)piperazine-1-carbonyl]-2H-phthalazin-1-one |
| SMILES | O=C(c1n[nH]c(=O)c2ccccc12)N1CCN(Cc2csc3ccccc23)CC1 |
| InChI | InChI=1S/C22H20N4O2S/c27-21-18-7-2-1-6-17(18)20(23-24-21)22(28)26-11-9-25(10-12-26)13-15-14-29-19-8-4-3-5-16(15)19/h1-8,14H,9-13H2,(H,24,27) |
| InChIKey | LWHLLVWZBBBBKV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |