C21H21FN2OS — CID 33261222
[4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]-(5-fluoro-2-methylphenyl)methanone (PubChem CID 33261222) has the molecular formula C21H21FN2OS and a molecular weight of 368.48 g/mol. Its IUPAC name is [4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]-(5-fluoro-2-methylphenyl)methanone.
| Compound Name | [4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]-(5-fluoro-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 33261222 |
| Molecular Formula | C21H21FN2OS |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]-(5-fluoro-2-methylphenyl)methanone |
| SMILES | Cc1ccc(F)cc1C(=O)N1CCN(Cc2csc3ccccc23)CC1 |
| InChI | InChI=1S/C21H21FN2OS/c1-15-6-7-17(22)12-19(15)21(25)24-10-8-23(9-11-24)13-16-14-26-20-5-3-2-4-18(16)20/h2-7,12,14H,8-11,13H2,1H3 |
| InChIKey | QBXKSYOQNKRTES-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |