C14H18N2O4 — CID 122021374
4-[(5-methoxy-2,3-dihydroindole-1-carbonyl)amino]butanoic acid (PubChem CID 122021374) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-[(5-methoxy-2,3-dihydroindole-1-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(5-methoxy-2,3-dihydroindole-1-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 122021374 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-[(5-methoxy-2,3-dihydroindole-1-carbonyl)amino]butanoic acid |
| SMILES | COc1ccc2c(c1)CCN2C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C14H18N2O4/c1-20-11-4-5-12-10(9-11)6-8-16(12)14(19)15-7-2-3-13(17)18/h4-5,9H,2-3,6-8H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | HDTMTNKYGXYDAJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|